Piperazine adipate
-
CAS Number 142-88-1
-
Catalog Number io-20464
-
Classification Salts
-
Molecular Weight 232.2800
-
SMILES C1CNCCN1.C(CCC(=O)O)CC(=O)O
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Piperazine adipate is a piperazinium salt obtained by combining equimolar amounts of piperazine and adipic acid. It has a role as an anthelminthic drug and an antinematodal drug. It contains an adipate(2-) and a piperazinium(2+).
| 1 | Piperazine adipate |
| 2 | Adiprazina |
| 3 | Adiprazine |
| 4 | Vermicompren |
| 5 | Arduvermin |
| Molecular Formula | C10H20N2O4 |
|---|---|
| Canonical SMILES | C1CNCCN1.C(CCC(=O)O)CC(=O)O |
| Isomeric SMILES | C1CNCCN1.C(CCC(=O)O)CC(=O)O |
| Molecular Weight | 232.2800 |
| InChIKey | BVEGEKOBSPXUJS-UHFFFAOYSA-N |
| InChI | InChI=1S/C6H10O4.C4H10N2/c7-5(8)3-1-2-4-6(9)10;1-2-6-4-3-5-1/h1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| XLogP | 0.0000 |
| ExactMass | 232.1423 |
| MonoisotopicMass | 232.1423 |
| TPSA | 98.7000 |
| Complexity | 140.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 4 |
| HBondAcceptorCount | 6 |
| RotatableBondCount | 5 |
| HeavyAtomCount | 16 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 435 |
| PatentFamilyCount | 189 |
| LiteratureCount | 90 |
