Maleic acid
-
CAS Number 110-16-7
-
Catalog Number io-2580
-
Classification Acids
-
Molecular Weight 116.0700
-
SMILES C(=CC(=O)O)C(=O)O
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Maleic acid is a butenedioic acid in which the double bond has cis- (Z)-configuration. It has a role as a plant metabolite, an algal metabolite and a mouse metabolite. It is a conjugate acid of a maleate(1-) and a maleate.
| 1 | maleic acid |
| 2 | cis-butenedioic acid |
| 3 | Toxilic acid |
| 4 | Maleinic acid |
| 5 | Malenic acid |
| Molecular Formula | C4H4O4 |
|---|---|
| Canonical SMILES | C(=CC(=O)O)C(=O)O |
| Isomeric SMILES | C(=C\C(=O)O)\C(=O)O |
| Molecular Weight | 116.0700 |
| InChIKey | VZCYOOQTPOCHFL-UPHRSURJSA-N |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
| XLogP | -0.3000 |
| ExactMass | 116.0110 |
| MonoisotopicMass | 116.0110 |
| TPSA | 74.6000 |
| Complexity | 119.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 8 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 1 |
| DefinedBondStereoCount | 1 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 28631 |
| PatentFamilyCount | 19048 |
| LiteratureCount | 6512 |
