Maneb
-
CAS Number 12427-38-2
-
Catalog Number io-2584
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 265.3000
-
SMILES C(CNC(=S)[S-])NC(=S)[S-].[Mn+2]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Maneb can cause cancer according to The Environmental Protection Agency (EPA).
| 1 | MANEB |
| 2 | Manebgan |
| 3 | Trimangol |
| 4 | Maneb 80 |
| 5 | Manzate |
| Molecular Formula | C4H6MnN2S4 |
|---|---|
| Canonical SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Mn+2] |
| Isomeric SMILES | C(CNC(=S)[S-])NC(=S)[S-].[Mn+2] |
| Molecular Weight | 265.3000 |
| InChIKey | YKSNLCVSTHTHJA-UHFFFAOYSA-L |
| InChI | InChI=1S/C4H8N2S4.Mn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2 |
| XLogP | 0.0000 |
| ExactMass | 264.8794 |
| MonoisotopicMass | 264.8794 |
| TPSA | 90.2000 |
| Complexity | 108.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 11 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 35471 |
| PatentFamilyCount | 9972 |
| LiteratureCount | 702 |