Potassium dimethyldithiocarbamate
-
CAS Number 128-03-0
-
Catalog Number io-2894
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 159.3200
-
SMILES CN(C)C(=S)[S-].[K+]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Potassium dimethyldithiocarbamate can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | POTASSIUM DIMETHYLDITHIOCARBAMATE |
| 2 | Busan 85 |
| 3 | Potassium dimethyl dithiocarbamate |
| 4 | Potassium N,N-dimethyldithiocarbamate |
| 5 | Arylane |
| Molecular Formula | C3H6KNS2 |
|---|---|
| Canonical SMILES | CN(C)C(=S)[S-].[K+] |
| Isomeric SMILES | CN(C)C(=S)[S-].[K+] |
| Molecular Weight | 159.3200 |
| InChIKey | TVPFLPJBESCUKI-UHFFFAOYSA-M |
| InChI | InChI=1S/C3H7NS2.K/c1-4(2)3(5)6;/h1-2H3,(H,5,6);/q;+1/p-1 |
| XLogP | 0.0000 |
| ExactMass | 158.9579 |
| MonoisotopicMass | 158.9579 |
| TPSA | 36.3000 |
| Complexity | 64.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 7 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 970 |
| PatentFamilyCount | 411 |
| LiteratureCount | 31 |