Methacrylic Acid
-
CAS Number 79-41-4
-
Catalog Number io-406916
-
Molecular Weight 86.0900
-
SMILES
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Methacrylic acid is an alpha,beta-unsaturated monocarboxylic acid that is acrylic acid in which the hydrogen at position 2 is substituted by a methyl group. It is functionally related to an acrylic acid. It is a conjugate acid of a methacrylate.
| 1 | METHACRYLIC ACID |
| 2 | 2-methylprop-2-enoic acid |
| 3 | 2-Methylacrylic acid |
| 4 | Methylacrylic acid |
| 5 | 2-Propenoic acid, 2-methyl- |
| Molecular Formula | C4H6O2 |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 86.0900 |
| InChIKey | CERQOIWHTDAKMF-UHFFFAOYSA-N |
| InChI | InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6) |
| XLogP | 0.9000 |
| ExactMass | 86.0368 |
| MonoisotopicMass | 86.0368 |
| TPSA | 37.3000 |
| Complexity | 83.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 1 |
| HeavyAtomCount | 6 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 454731 |
| PatentFamilyCount | 212981 |
| LiteratureCount | 9299 |
