4-(N-Propionylaniline)piperidine
-
CAS Number 1609-66-1
-
Catalog Number io-406930
-
Molecular Weight 232.3200
-
SMILES
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Norfentanyl is a monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of 4-(N'-phenyl)piperidin-4-amine with propanoic acid. A major metabolite of fentanyl. It has a role as an opioid analgesic and a drug metabolite. It is an anilide, a member of piperidines and a monocarboxylic acid amide.
| 1 | Norfentanyl |
| 2 | N-phenyl-N-(piperidin-4-yl)propionamide |
| 3 | Propanamide, N-phenyl-N-4-piperidinyl- |
| 4 | N-PHENYL-N-(PIPERIDIN-4-YL)PROPANAMIDE |
| 5 | N-phenyl-N-4-piperidinylpropionamide |
| Molecular Formula | C14H20N2O |
|---|---|
| Canonical SMILES | |
| Isomeric SMILES | |
| Molecular Weight | 232.3200 |
| InChIKey | PMCBDBWCQQBSRJ-UHFFFAOYSA-N |
| InChI | InChI=1S/C14H20N2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13/h3-7,13,15H,2,8-11H2,1H3 |
| XLogP | 1.6000 |
| ExactMass | 232.1576 |
| MonoisotopicMass | 232.1576 |
| TPSA | 32.3000 |
| Complexity | 243.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 17 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 397 |
| PatentFamilyCount | 147 |
| LiteratureCount | 101 |
