DL-Tryptophan
-
CAS Number 54-12-6
-
Catalog Number io-59980
-
Classification Salts
-
Molecular Weight 204.2200
-
SMILES C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Tryptophan is an alpha-amino acid that is alanine bearing an indol-3-yl substituent at position 3. It has a role as a Daphnia magna metabolite. It is an alpha-amino acid, an aminoalkylindole, a polar amino acid and an aromatic amino acid. It contains a 1H-indol-3-ylmethyl group. It is a conjugate base of a tryptophanium. It is a conjugate acid of a tryptophanate. It is a tautomer of a tryptophan zwitterion.
| 1 | DL-Tryptophan |
| 2 | 2-amino-3-(1H-indol-3-yl)propanoic acid |
| 3 | Racemic Tryptophan |
| 4 | DL-Trytophane |
| 5 | DL-Trytophan |
| Molecular Formula | C11H12N2O2 |
|---|---|
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
| Molecular Weight | 204.2200 |
| InChIKey | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15) |
| XLogP | -1.1000 |
| ExactMass | 204.0899 |
| MonoisotopicMass | 204.0899 |
| TPSA | 79.1000 |
| Complexity | 245.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 3 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 3 |
| HeavyAtomCount | 15 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 321194 |
| PatentFamilyCount | 97925 |
| LiteratureCount | 785 |