Carbendazim
-
CAS Number 10605-21-7
-
Catalog Number io-1919
-
Classification Amines
-
Molecular Weight 191.1900
-
SMILES COC(=O)NC1=NC2=CC=CC=C2N1
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Carbendazim is a member of the class of benzimidazoles that is 2-aminobenzimidazole in which the primary amino group is substituted by a methoxycarbonyl group. A fungicide, carbendazim controls Ascomycetes, Fungi Imperfecti, and Basidiomycetes on a wide variety of crops, including bananas, cereals, cotton, fruits, grapes, mushrooms, ornamentals, peanuts, sugarbeet, soybeans, tobacco, and vegetables. It has a role as an antinematodal drug, a metabolite, a microtubule-destabilising agent and an antifungal agrochemical. It is a carbamate ester, a member of benzimidazoles, a benzimidazole fungicide and a benzimidazolylcarbamate fungicide. It is functionally related to a 2-aminobenzimidazole.
| 1 | Carbendazim |
| 2 | Carbendazole |
| 3 | Mecarzole |
| 4 | Bavistin |
| 5 | Thicoper |
| Molecular Formula | C9H9N3O2 |
|---|---|
| Canonical SMILES | COC(=O)NC1=NC2=CC=CC=C2N1 |
| Isomeric SMILES | COC(=O)NC1=NC2=CC=CC=C2N1 |
| Molecular Weight | 191.1900 |
| InChIKey | TWFZGCMQGLPBSX-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13) |
| XLogP | 1.5000 |
| ExactMass | 191.0695 |
| MonoisotopicMass | 191.0695 |
| TPSA | 67.0000 |
| Complexity | 222.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 3 |
| RotatableBondCount | 2 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 42492 |
| PatentFamilyCount | 15218 |
| LiteratureCount | 5197 |