Cyclophosphamide
-
CAS Number 50-18-0
-
Catalog Number io-2073
-
Classification Amines
-
Molecular Weight 261.0800
-
SMILES C1CNP(=O)(OC1)N(CCCl)CCCl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Cyclophosphamide (Hydrated) can cause cancer according to California Labor Code. It can cause developmental toxicity according to an independent committee of scientific and health experts. It can cause female reproductive toxicity and male reproductive toxicity according to state or federal government labeling requirements.
| 1 | cyclophosphamide |
| 2 | Cytoxan |
| 3 | Cyclophosphamid |
| 4 | Cyclophosphane |
| 5 | Endoxan |
| Molecular Formula | C7H15Cl2N2O2P |
|---|---|
| Canonical SMILES | C1CNP(=O)(OC1)N(CCCl)CCCl |
| Isomeric SMILES | C1CNP(=O)(OC1)N(CCCl)CCCl |
| Molecular Weight | 261.0800 |
| InChIKey | CMSMOCZEIVJLDB-UHFFFAOYSA-N |
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14/h1-7H2,(H,10,12) |
| XLogP | 0.6000 |
| ExactMass | 260.0248 |
| MonoisotopicMass | 260.0248 |
| TPSA | 41.6000 |
| Complexity | 212.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 5 |
| HeavyAtomCount | 14 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 1 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 1 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 199306 |
| PatentFamilyCount | 53893 |
| LiteratureCount | 119777 |