Metham sodium
-
CAS Number 137-42-8
-
Catalog Number io-2615
-
Classification Thiocarbamate Esters and Salts/Dithiocarbamate Esters and Salts
-
Molecular Weight 129.1800
-
SMILES CNC(=S)[S-].[Na+]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Metham Sodium can cause cancer and developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | Metam-sodium |
| 2 | Metham sodium |
| 3 | Metam sodium |
| 4 | Carbathione |
| 5 | Carbathion |
| Molecular Formula | C2H4NNaS2 |
|---|---|
| Canonical SMILES | CNC(=S)[S-].[Na+] |
| Isomeric SMILES | CNC(=S)[S-].[Na+] |
| Molecular Weight | 129.1800 |
| InChIKey | AFCCDDWKHLHPDF-UHFFFAOYSA-M |
| InChI | InChI=1S/C2H5NS2.Na/c1-3-2(4)5;/h1H3,(H2,3,4,5);/q;+1/p-1 |
| XLogP | 0.0000 |
| ExactMass | 128.9683 |
| MonoisotopicMass | 128.9683 |
| TPSA | 45.1000 |
| Complexity | 46.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 1 |
| HBondAcceptorCount | 2 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 6 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 2 |
| PatentCount | 18989 |
| PatentFamilyCount | 6734 |
| LiteratureCount | 570 |