Oxydiazon
-
CAS Number 19666-30-9
-
Catalog Number io-2793
-
Classification Aryl Halides
-
Molecular Weight 345.2000
-
SMILES CC(C)OC1=C(C=C(C(=C1)N2C(=O)OC(=N2)C(C)(C)C)Cl)Cl
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Oxadiazon can cause cancer according to an independent committee of scientific and health experts. It can cause developmental toxicity according to The Environmental Protection Agency (EPA).
| 1 | OXADIAZON |
| 2 | Ronstar |
| 3 | Oxadiazone |
| 4 | Oxydiazon |
| 5 | RP 17623 |
| Molecular Formula | C15H18Cl2N2O3 |
|---|---|
| Canonical SMILES | CC(C)OC1=C(C=C(C(=C1)N2C(=O)OC(=N2)C(C)(C)C)Cl)Cl |
| Isomeric SMILES | CC(C)OC1=C(C=C(C(=C1)N2C(=O)OC(=N2)C(C)(C)C)Cl)Cl |
| Molecular Weight | 345.2000 |
| InChIKey | CHNUNORXWHYHNE-UHFFFAOYSA-N |
| InChI | InChI=1S/C15H18Cl2N2O3/c1-8(2)21-12-7-11(9(16)6-10(12)17)19-14(20)22-13(18-19)15(3,4)5/h6-8H,1-5H3 |
| XLogP | 4.8000 |
| ExactMass | 344.0694 |
| MonoisotopicMass | 344.0694 |
| TPSA | 51.1000 |
| Complexity | 462.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 4 |
| HeavyAtomCount | 22 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 27954 |
| PatentFamilyCount | 6739 |
| LiteratureCount | 388 |
