Ammonium Sulfate
-
CAS Number 7783-20-2
-
Catalog Number io-39223
-
Classification Salts
-
Molecular Weight 132.1400
-
SMILES [NH4+].[NH4+].[O-]S(=O)(=O)[O-]
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
Ammonium sulfate is an inorganic sulfate salt obtained by reaction of sulfuric acid with two equivalents of ammonia. A high-melting (decomposes above 280###) white solid which is very soluble in water (70.6 g/100 g water at 0###; 103.8 g/100 g water at 100###), it is widely used as a fertilizer for alkaline soils. It has a role as a fertilizer. It is an ammonium salt and an inorganic sulfate salt.
| 1 | AMMONIUM SULFATE |
| 2 | Ammonium sulphate |
| 3 | Diammonium sulfate |
| 4 | Mascagnite |
| 5 | Sulfuric acid diammonium salt |
| Molecular Formula | H8N2O4S |
|---|---|
| Canonical SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)[O-] |
| Isomeric SMILES | [NH4+].[NH4+].[O-]S(=O)(=O)[O-] |
| Molecular Weight | 132.1400 |
| InChIKey | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| InChI | InChI=1S/2H3N.H2O4S/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4) |
| XLogP | 0.0000 |
| ExactMass | 132.0205 |
| MonoisotopicMass | 132.0205 |
| TPSA | 90.6000 |
| Complexity | 62.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 2 |
| HBondAcceptorCount | 4 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 7 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 0 |
| DefinedAtomStereoCount | 0 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 3 |
| PatentCount | 454 |
| PatentFamilyCount | 252 |
| LiteratureCount | 52000 |
