Camphor (synthetic)
-
CAS Number 464-49-3
-
Catalog Number io-59039
-
Classification Ethers
-
Molecular Weight 152.2300
-
SMILES CC1(C2CCC1(C(=O)C2)C)C
| Size | QTY | Notes | |
|---|---|---|---|
|
|
|
Add |
(R)-camphor is the (R)- enantiomer of camphor. It is an enantiomer of a (S)-camphor.
| 1 | D-CAMPHOR |
| 2 | (+)-Camphor |
| 3 | (R)-(+)-Camphor |
| 4 | (R)-Camphor |
| 5 | (1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| Molecular Formula | C10H16O |
|---|---|
| Canonical SMILES | CC1(C2CCC1(C(=O)C2)C)C |
| Isomeric SMILES | C[C@@]12CC[C@@H](C1(C)C)CC2=O |
| Molecular Weight | 152.2300 |
| InChIKey | DSSYKIVIOFKYAU-XCBNKYQSSA-N |
| InChI | InChI=1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| XLogP | 2.2000 |
| ExactMass | 152.1201 |
| MonoisotopicMass | 152.1201 |
| TPSA | 17.1000 |
| Complexity | 217.0000 |
| Charge | 0.0000 |
| HBondDonorCount | 0 |
| HBondAcceptorCount | 1 |
| RotatableBondCount | 0 |
| HeavyAtomCount | 11 |
| IsotopeAtomCount | 0 |
| AtomStereoCount | 2 |
| DefinedAtomStereoCount | 2 |
| UndefinedAtomStereoCount | 0 |
| BondStereoCount | 0 |
| DefinedBondStereoCount | 0 |
| UndefinedBondStereoCount | 0 |
| CovalentUnitCount | 1 |
| PatentCount | 54403 |
| PatentFamilyCount | 19982 |
| LiteratureCount | 521 |
